Difference between revisions of "Ec-13 002370"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] == * smiles: ** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])...")
(Created page with "Category:Gene == Gene Ec-13_002370 == * left end position: ** 4068449 * transcription direction: ** POSITIVE * right end position: ** 4071468 * centisome position: ** 58.6...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] ==
+
== Gene Ec-13_002370 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O
+
** 4068449
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-cis-dodecenoyl-CoA
+
** 4071468
−
* molecular weight:
+
* centisome position:
−
** 943.792    
+
** 58.65474    
 
* Synonym(s):
 
* Synonym(s):
−
** 12:1(n-9)
+
** Esi_0386_0005
−
** 12:1 cis-3
+
** Esi0386_0005
−
** cis-3-dodecenoyl-CoA
+
** GST
−
** (3Z)-dodecenoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GSHTRAN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-7931]]
+
*** Assignment: ec-number
 +
* Reaction: [[GST-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13673]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15680]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4068449}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659197 90659197]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=4071468}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27989 27989]
+
{{#set: centisome position=58.65474   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0386_0005|Esi0386_0005|GST}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02944 C02944]
+
{{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
−
* HMDB : HMDB04257
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
−
{{#set: smiles=CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O}}
+
−
{{#set: inchi key=InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J}}
+
−
{{#set: common name=3-cis-dodecenoyl-CoA}}
+
−
{{#set: molecular weight=943.792   }}
+
−
{{#set: common name=12:1(n-9)|12:1 cis-3|cis-3-dodecenoyl-CoA|(3Z)-dodecenoyl-CoA}}
+
−
{{#set: reversible reaction associated=RXN-7931}}
+

Latest revision as of 19:47, 21 March 2018

Gene Ec-13_002370

  • left end position:
    • 4068449
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4071468
  • centisome position:
    • 58.65474
  • Synonym(s):
    • Esi_0386_0005
    • Esi0386_0005
    • GST

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-13_002370&oldid=29344"