Difference between revisions of "Ec-25 001900"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CITRULLINE L-CITRULLINE] == * smiles: ** C(NC(N)=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-25_001900 == * left end position: ** 2209704 * transcription direction: ** NEGATIVE * right end position: ** 2224657 * centisome position: ** 49.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-25_001900 == |
− | * | + | * left end position: |
− | ** | + | ** 2209704 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2224657 |
− | * | + | * centisome position: |
− | ** | + | ** 49.645805 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0116_0039 |
− | ** | + | ** Esi0116_0039 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[FORMATETHFLIG-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[PWY-2201]] |
+ | * [[PWY-1722]] | ||
+ | * [[PWY-2161]] | ||
+ | * [[CODH-PWY]] | ||
+ | * [[PWY-3841]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2209704}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2224657}} | |
− | + | {{#set: centisome position=49.645805 }} | |
− | + | {{#set: common name=Esi_0116_0039|Esi0116_0039}} | |
− | + | {{#set: reaction associated=FORMATETHFLIG-RXN}} | |
− | + | {{#set: pathway associated=PWY-2201|PWY-1722|PWY-2161|CODH-PWY|PWY-3841}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:47, 21 March 2018
Gene Ec-25_001900
- left end position:
- 2209704
- transcription direction:
- NEGATIVE
- right end position:
- 2224657
- centisome position:
- 49.645805
- Synonym(s):
- Esi_0116_0039
- Esi0116_0039
Reactions associated
- Reaction: FORMATETHFLIG-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome