Difference between revisions of "CPD-7221"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-905 RXN-905] == * direction: ** LEFT-TO-RIGHT * common name: ** 6-phosphogluconate dehydrogenas...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] == * smiles: ** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O |
| + | * inchi key: | ||
| + | ** InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-cis-dodecenoyl-CoA |
| − | + | * molecular weight: | |
| − | * | + | ** 943.792 |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| + | ** 12:1(n-9) | ||
| + | ** 12:1 cis-3 | ||
| + | ** cis-3-dodecenoyl-CoA | ||
| + | ** (3Z)-dodecenoyl-CoA | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-7931]] | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | * | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659197 90659197] | |
| − | {{#set: | + | * CHEBI: |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27989 27989] | |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02944 C02944] |
| − | {{#set: | + | * HMDB : HMDB04257 |
| − | {{#set: | + | {{#set: smiles=CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J}} |
| + | {{#set: common name=3-cis-dodecenoyl-CoA}} | ||
| + | {{#set: molecular weight=943.792 }} | ||
| + | {{#set: common name=12:1(n-9)|12:1 cis-3|cis-3-dodecenoyl-CoA|(3Z)-dodecenoyl-CoA}} | ||
| + | {{#set: reversible reaction associated=RXN-7931}} | ||
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite CPD-7221
- smiles:
- CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O
- inchi key:
- InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J
- common name:
- 3-cis-dodecenoyl-CoA
- molecular weight:
- 943.792
- Synonym(s):
- 12:1(n-9)
- 12:1 cis-3
- cis-3-dodecenoyl-CoA
- (3Z)-dodecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O" cannot be used as a page name in this wiki.
