Difference between revisions of "RXN-9657"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7630 CPD-7630] == * smiles: ** C3(=C(C2(OC1(=CC(=CC(=C1CC2O)O)O)))C=C(O)C(=C3)O) * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9657 RXN-9657] == * direction: ** LEFT-TO-RIGHT * common name: ** crotonyl-[acp] reductase ** G...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9657 RXN-9657] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** crotonyl-[acp] reductase |
− | * | + | ** Glucose/ribitol dehydrogenase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[Crotonyl-ACPs]][c] '''=>''' 1 [[Butanoyl-ACPs]][c] '''+''' 1 [[NAD]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 a crotonyl-[acp][c] '''=>''' 1 a butyryl-[acp][c] '''+''' 1 NAD+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-27_002470]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971] | ||
+ | ** '''28''' reactions found over '''31''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=crotonyl-[acp] reductase}} | |
− | + | {{#set: common name=Glucose/ribitol dehydrogenase}} | |
− | + | {{#set: ec number=EC-1.3.1.9}} | |
− | + | {{#set: gene associated=Ec-27_002470}} | |
− | + | {{#set: in pathway=PWY-5971}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:48, 21 March 2018
Contents
Reaction RXN-9657
- direction:
- LEFT-TO-RIGHT
- common name:
- crotonyl-[acp] reductase
- Glucose/ribitol dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 NADH[c] + 1 Crotonyl-ACPs[c] => 1 Butanoyl-ACPs[c] + 1 NAD[c]
- With common name(s):
- 1 H+[c] + 1 NADH[c] + 1 a crotonyl-[acp][c] => 1 a butyryl-[acp][c] + 1 NAD+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-27_002470
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
- 28 reactions found over 31 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
"crotonyl-[acp] reductase" cannot be used as a page name in this wiki.