Difference between revisions of "ALA-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6224 CPD-6224] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-tRNAs ALA-tRNAs] == * common name: ** a tRNAala * Synonym(s): ** TRNA(ALA) == Reaction(s)...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6224 CPD-6224] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-tRNAs ALA-tRNAs] ==
* smiles:
+
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
* inchi key:
+
** InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M
+
 
* common name:
 
* common name:
** gibberellin A34
+
** a tRNAala
* molecular weight:
+
** 347.387   
+
 
* Synonym(s):
 
* Synonym(s):
** GA34
+
** TRNA(ALA)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ALANINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-6550]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104170025
+
{{#set: common name=a tRNAala}}
* PUBCHEM:
+
{{#set: common name=TRNA(ALA)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245079 25245079]
+
{{#set: consumed by=ALANINE--TRNA-LIGASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29593 29593]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11868 C11868]
+
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M}}
+
{{#set: common name=gibberellin A34}}
+
{{#set: molecular weight=347.387    }}
+
{{#set: common name=GA34}}
+
{{#set: produced by=RXN-6550}}
+

Latest revision as of 19:49, 21 March 2018

Metabolite ALA-tRNAs

  • common name:
    • a tRNAala
  • Synonym(s):
    • TRNA(ALA)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links