Difference between revisions of "Ec-15 002920"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * in...") |
(Created page with "Category:Gene == Gene Ec-15_002920 == * left end position: ** 3129065 * transcription direction: ** NEGATIVE * right end position: ** 3134392 * centisome position: ** 57.9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-15_002920 == |
− | * | + | * left end position: |
− | ** | + | ** 3129065 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3134392 |
− | * | + | * centisome position: |
− | ** | + | ** 57.9644 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0076_0061 |
+ | ** Esi0076_0061 | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[AMACETOXID-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[AMINEOXID-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[AMINEPHEN-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-11784]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-5821]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-6381]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-9597]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN6666-4]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7431]] | ||
+ | * [[PWY-3981]] | ||
+ | * [[THRDLCTCAT-PWY]] | ||
+ | * [[PWY6666-2]] | ||
+ | * [[2PHENDEG-PWY]] | ||
+ | * [[PWY-6802]] | ||
+ | * [[PWY-5751]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3129065}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3134392}} | |
− | + | {{#set: centisome position=57.9644 }} | |
− | + | {{#set: common name=Esi_0076_0061|Esi0076_0061}} | |
− | {{#set: | + | {{#set: reaction associated=AMACETOXID-RXN|AMINEOXID-RXN|AMINEPHEN-RXN|RXN-11784|RXN-5821|RXN-6381|RXN-9597|RXN6666-4}} |
− | {{#set: | + | {{#set: pathway associated=PWY-7431|PWY-3981|THRDLCTCAT-PWY|PWY6666-2|2PHENDEG-PWY|PWY-6802|PWY-5751}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:49, 21 March 2018
Gene Ec-15_002920
- left end position:
- 3129065
- transcription direction:
- NEGATIVE
- right end position:
- 3134392
- centisome position:
- 57.9644
- Synonym(s):
- Esi_0076_0061
- Esi0076_0061
Reactions associated
- Reaction: AMACETOXID-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Reaction: AMINEOXID-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: AMINEPHEN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Reaction: RXN-11784
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Reaction: RXN-5821
- Source: orthology-aragem
- Reaction: RXN-6381
- Source: orthology-aragem
- Reaction: RXN-9597
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN6666-4
- Source: orthology-aragem