Difference between revisions of "BIOTIN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-11_001530 == * left end position: ** 1613351 * transcription direction: ** NEGATIVE * right end position: ** 1613518 * centisome position: ** 25.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] == * smiles: ** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12)) * inchi key: ** InChIK...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YBJHBAHKTGYVGT-ZKWXMUAHSA-M |
| − | * | + | * common name: |
| − | ** | + | ** biotin |
| − | * | + | * molecular weight: |
| − | ** | + | ** 243.3 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** vitamin H |
| − | ** | + | ** coenzyme R |
| + | ** d-biotin | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[6.3.4.10-RXN]] |
| − | * | + | * [[6.3.4.9-RXN]] |
| − | + | * [[BIOTINLIG-RXN]] | |
| − | + | * [[6.3.4.11-RXN]] | |
| − | * | + | * [[TransportSeed_BIOTIN]] |
| − | + | * [[RXN0-7192]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[2.8.1.6-RXN]] |
| − | * | + | * [[TransportSeed_BIOTIN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | * [[ExchangeSeed_BIOTIN]] |
| − | + | * [[RXN-17473]] | |
| − | + | ||
| − | * | + | |
| − | + | ||
| − | + | ||
| − | * | + | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 58-85-5 |
| − | {{#set: | + | * BIGG : 33931 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6560210 6560210] |
| − | {{#set: common name= | + | * HMDB : HMDB00030 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00120 C00120] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5028036.html 5028036] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57586 57586] | ||
| + | * METABOLIGHTS : MTBLC57586 | ||
| + | {{#set: smiles=C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12))}} | ||
| + | {{#set: inchi key=InChIKey=YBJHBAHKTGYVGT-ZKWXMUAHSA-M}} | ||
| + | {{#set: common name=biotin}} | ||
| + | {{#set: molecular weight=243.3 }} | ||
| + | {{#set: common name=vitamin H|coenzyme R|d-biotin}} | ||
| + | {{#set: consumed by=6.3.4.10-RXN|6.3.4.9-RXN|BIOTINLIG-RXN|6.3.4.11-RXN|TransportSeed_BIOTIN|RXN0-7192}} | ||
| + | {{#set: produced by=2.8.1.6-RXN|TransportSeed_BIOTIN}} | ||
| + | {{#set: reversible reaction associated=ExchangeSeed_BIOTIN|RXN-17473}} | ||
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite BIOTIN
- smiles:
- C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12))
- inchi key:
- InChIKey=YBJHBAHKTGYVGT-ZKWXMUAHSA-M
- common name:
- biotin
- molecular weight:
- 243.3
- Synonym(s):
- vitamin H
- coenzyme R
- d-biotin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 58-85-5
- BIGG : 33931
- PUBCHEM:
- HMDB : HMDB00030
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57586
"C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12))" cannot be used as a page name in this wiki.
