Difference between revisions of "CPD0-2123"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-LIPID-HYDROPEROXIDE A-LIPID-HYDROPEROXIDE] == * common name: ** a hydroperoxy-fatty-acyl-[lip...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2123 CPD0-2123] == * smiles: ** CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2123 CPD0-2123] == |
+ | * smiles: | ||
+ | ** CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=AZCVXMAPLHSIKY-HSJNEKGZSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 3-oxodecanoyl-CoA |
+ | * molecular weight: | ||
+ | ** 931.738 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13617]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12490]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : 45458 |
− | {{#set: consumed by= | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262297 53262297] | ||
+ | * HMDB : HMDB03939 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05265 C05265] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62548 62548] | ||
+ | * METABOLIGHTS : MTBLC28528 | ||
+ | {{#set: smiles=CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=AZCVXMAPLHSIKY-HSJNEKGZSA-J}} | ||
+ | {{#set: common name=3-oxodecanoyl-CoA}} | ||
+ | {{#set: molecular weight=931.738 }} | ||
+ | {{#set: consumed by=RXN-13617}} | ||
+ | {{#set: produced by=RXN-12490}} |
Latest revision as of 19:50, 21 March 2018
Contents
Metabolite CPD0-2123
- smiles:
- CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=AZCVXMAPLHSIKY-HSJNEKGZSA-J
- common name:
- 3-oxodecanoyl-CoA
- molecular weight:
- 931.738
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 45458
- PUBCHEM:
- HMDB : HMDB03939
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC28528
"CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.