Difference between revisions of "RXNQT-4141"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] == * smiles: ** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4141 RXNQT-4141] == * direction: ** LEFT-TO-RIGHT * common name: ** GDP-L-galactose/GDP-D-glu...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4141 RXNQT-4141] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxy-(9Z)-hexadecenoyl-CoA
+
** GDP-L-galactose/GDP-D-glucose phosphorylase
* molecular weight:
+
* ec number:
** 1015.898   
+
** [http://enzyme.expasy.org/EC/2.7.7.69 EC-2.7.7.69]
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-16:1-Δ9-CoA
 
** (S)-3-hydroxy-9-cis-hexadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17790]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[Pi]][c] '''+''' 1 [[GDP-L-GALACTOSE]][c] '''=>''' 1 [[GDP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPDQT-4]][c]
* [[RXN-17789]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 phosphate[c] '''+''' 1 GDP-β-L-galactose[c] '''=>''' 1 GDP[c] '''+''' 1 H+[c] '''+''' 1 β-L-galactose 1-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-15_001960]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-882]], L-ascorbate biosynthesis I (L-galactose pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882]
 +
** '''7''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* RHEA:
{{#set: inchi key=InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J}}
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27698 27698]
{{#set: common name=(S)-3-hydroxy-(9Z)-hexadecenoyl-CoA}}
+
* LIGAND-RXN:
{{#set: molecular weight=1015.898    }}
+
** [http://www.genome.jp/dbget-bin/www_bget?R07678 R07678]
{{#set: common name=(S)-3-hydroxy-16:1-Δ9-CoA|(S)-3-hydroxy-9-cis-hexadecenoyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: consumed by=RXN-17790}}
+
{{#set: common name=GDP-L-galactose/GDP-D-glucose phosphorylase}}
{{#set: produced by=RXN-17789}}
+
{{#set: ec number=EC-2.7.7.69}}
 +
{{#set: gene associated=Ec-15_001960}}
 +
{{#set: in pathway=PWY-882}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:51, 21 March 2018

Reaction RXNQT-4141

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • GDP-L-galactose/GDP-D-glucose phosphorylase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 phosphate[c] + 1 GDP-β-L-galactose[c] => 1 GDP[c] + 1 H+[c] + 1 β-L-galactose 1-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-882, L-ascorbate biosynthesis I (L-galactose pathway): PWY-882
    • 7 reactions found over 8 reactions in the full pathway

Reconstruction information

External links