Difference between revisions of "ExchangeSeed CO+2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * inchi key...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_CO+2 ExchangeSeed_CO+2] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formu...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_CO+2 ExchangeSeed_CO+2] ==
−
* smiles:
+
* direction:
−
** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
+
−
* common name:
+
−
** queuine
+
−
* molecular weight:
+
−
** 278.29   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
 
−
** base Q
 
−
** 4H-pyrrolo(2,3-d)pyrimidin-4-one, 2-amino-5-((((1S,4S,5R)-4,5-dihydroxy-2-cyclopenten-1-yl)amino)methyl)-1,7-dihydro-
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1.0 [[CO+2]][C-BOUNDARY] '''<=>''' 1.0 [[CO+2]][e]
−
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
+
* With common name(s):
 +
** 1.0 Co2+[C-BOUNDARY] '''<=>''' 1.0 Co2+[e]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from boundary to extracellular compartment]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289319 86289319]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=manual}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674]
+
{{#set: reconstruction source=manual-import_from_medium}}
−
* HMDB : HMDB01495
+
{{#set: reconstruction comment=added to manage seeds from boundary to extracellular compartment}}
−
{{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}}
+
−
{{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}}
+
−
{{#set: common name=queuine}}
+
−
{{#set: molecular weight=278.29    }}
+
−
{{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q|4H-pyrrolo(2,3-d)pyrimidin-4-one, 2-amino-5-((((1S,4S,5R)-4,5-dihydroxy-2-cyclopenten-1-yl)amino)methyl)-1,7-dihydro-}}
+
−
{{#set: reversible reaction associated=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}}
+

Latest revision as of 19:51, 21 March 2018

Reaction ExchangeSeed_CO+2

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 Co2+[C-BOUNDARY] <=> 1.0 Co2+[e]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ExchangeSeed_CO%2B2&oldid=29785"