|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHENYLTHFCYCLOHYDRO-RXN METHENYLTHFCYCLOHYDRO-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4))) |
| + | * inchi key: |
| + | ** InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M |
| * common name: | | * common name: |
− | ** Tetrahydrofolate dehydrogenase/cyclohydrolase | + | ** delphinidin-3-O-β-D-glucoside |
− | ** Tetrahydrofolate dehydrogenase/cyclohydrolase, catalytic domain | + | * molecular weight: |
− | * ec number:
| + | ** 463.374 |
− | ** [http://enzyme.expasy.org/EC/3.5.4.9 EC-3.5.4.9] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** delfinidin-3-O-glucoside |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-8228]] |
− | ** 1 [[WATER]][c] '''+''' 1 [[5-10-METHENYL-THF-GLU-N]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[FORMYL-THF-GLU-N]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 H2O[c] '''+''' 1 a 5,10-methenyltetrahydrofolate[c] '''<=>''' 1 H+[c] '''+''' 1 an N10-formyl-tetrahydrofolate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * Gene: [[Ec-14_004070]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: AUTOMATED-NAME-MATCH
| + | |
− | * Gene: [[Ec-15_001370]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: AUTOMATED-NAME-MATCH
| + | |
− | == Pathways ==
| + | |
− | * [[PWY-1722]], formate assimilation into 5,10-methylenetetrahydrofolate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1722 PWY-1722]
| + | |
− | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-3841]], folate transformations II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841]
| + | |
− | ** '''10''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[1CMET2-PWY]], N10-formyl-tetrahydrofolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=1CMET2-PWY 1CMET2-PWY]
| + | |
− | ** '''9''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-5030]], L-histidine degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5030 PWY-5030] | + | |
− | ** '''2''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[P164-PWY]], purine nucleobases degradation I (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=P164-PWY P164-PWY]
| + | |
− | ** '''4''' reactions found over '''17''' reactions in the full pathway
| + | |
− | * [[CODH-PWY]], reductive acetyl coenzyme A pathway I (homoacetogenic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=CODH-PWY CODH-PWY]
| + | |
− | ** '''5''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-5497]], purine nucleobases degradation II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5497 PWY-5497]
| + | |
− | ** '''8''' reactions found over '''24''' reactions in the full pathway
| + | |
− | * [[PWY-2201]], folate transformations I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2201 PWY-2201]
| + | |
− | ** '''12''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-6613]], tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6613 PWY-6613]
| + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * LIPID_MAPS : LMPK12010278 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23700 23700] | + | * PUBCHEM: |
− | * LIGAND-RXN:
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=165559 165559] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01655 R01655] | + | * CHEBI: |
− | * UNIPROT:
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31463 31463] |
− | ** [http://www.uniprot.org/uniprot/P09440 P09440]
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P07245 P07245]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C12138 C12138] |
− | ** [http://www.uniprot.org/uniprot/P11586 P11586] | + | * HMDB : HMDB37997 |
− | ** [http://www.uniprot.org/uniprot/P18155 P18155] | + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))}} |
− | ** [http://www.uniprot.org/uniprot/P44313 P44313]
| + | {{#set: inchi key=InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M}} |
− | ** [http://www.uniprot.org/uniprot/P47259 P47259]
| + | {{#set: common name=delphinidin-3-O-β-D-glucoside}} |
− | ** [http://www.uniprot.org/uniprot/P13995 P13995] | + | {{#set: molecular weight=463.374 }} |
− | ** [http://www.uniprot.org/uniprot/P54382 P54382] | + | {{#set: common name=delfinidin-3-O-glucoside}} |
− | ** [http://www.uniprot.org/uniprot/O67736 O67736] | + | {{#set: consumed by=RXN-8228}} |
− | ** [http://www.uniprot.org/uniprot/Q9JWI9 Q9JWI9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PP68 Q9PP68]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24186 P24186]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04448 Q04448]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60006 Q60006]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27772 Q27772]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51696 P51696]
| + | |
− | ** [http://www.uniprot.org/uniprot/O68031 O68031]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZTV0 Q9ZTV0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9X7F6 Q9X7F6]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=Tetrahydrofolate dehydrogenase/cyclohydrolase}}
| + | |
− | {{#set: common name=Tetrahydrofolate dehydrogenase/cyclohydrolase, catalytic domain}}
| + | |
− | {{#set: ec number=EC-3.5.4.9}}
| + | |
− | {{#set: gene associated=Ec-14_004070|Ec-15_001370}} | + | |
− | {{#set: in pathway=PWY-1722|PWY-3841|1CMET2-PWY|PWY-5030|P164-PWY|CODH-PWY|PWY-5497|PWY-2201|PWY-6613}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome}} | + | |
− | {{#set: reconstruction tool=pathwaytools}} | + | |