Difference between revisions of "Reduced-ferredoxins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == * smiles: ** C(CC(C(=O)[O-])[N+])ONC(N)=O * inchi key...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-ferredoxins Reduced-ferredoxins] == * common name: ** a reduced ferredoxin [iron-sulfur...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-ferredoxins Reduced-ferredoxins] ==
* smiles:
+
** C(CC(C(=O)[O-])[N+])ONC(N)=O
+
* inchi key:
+
** InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N
+
 
* common name:
 
* common name:
** O-ureidohomoserine
+
** a reduced ferredoxin [iron-sulfur] cluster
* molecular weight:
+
** 177.16   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a reduced ferredoxin
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10]]
+
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
 +
* [[1.3.7.4-RXN]]
 +
* [[ISPH2-RXN]]
 +
* [[RXN-7741]]
 +
* [[RXN-7740]]
 +
* [[RXN-17252]]
 +
* [[RXN0-882]]
 +
* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
 +
* [[RXN-5061]]
 +
* [[1.3.7.3-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 +
* [[1.18.1.2-RXN]]
 +
* [[RXN0-884]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9]]
+
* [[RXN-15468]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-12878]]
 +
* [[HYDROG-RXN]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a reduced ferredoxin [iron-sulfur] cluster}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820483 91820483]
+
{{#set: common name=a reduced ferredoxin}}
* HMDB : HMDB12271
+
{{#set: consumed by=FERREDOXIN--NITRITE-REDUCTASE-RXN|1.3.7.4-RXN|ISPH2-RXN|RXN-7741|RXN-7740|RXN-17252|RXN0-882|SULFITE-REDUCTASE-FERREDOXIN-RXN|RXN-5061|1.3.7.3-RXN|GLUTAMATE-SYNTHASE-FERREDOXIN-RXN|1.18.1.2-RXN|RXN0-884}}
{{#set: smiles=C(CC(C(=O)[O-])[N+])ONC(N)=O}}
+
{{#set: produced by=RXN-15468}}
{{#set: inchi key=InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N}}
+
{{#set: reversible reaction associated=RXN-12878|HYDROG-RXN|PYRUFLAVREDUCT-RXN}}
{{#set: common name=O-ureidohomoserine}}
+
{{#set: molecular weight=177.16    }}
+
{{#set: consumed by=RXN-10}}
+
{{#set: produced by=RXN-9}}
+

Latest revision as of 20:52, 21 March 2018

Metabolite Reduced-ferredoxins

  • common name:
    • a reduced ferredoxin [iron-sulfur] cluster
  • Synonym(s):
    • a reduced ferredoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a reduced ferredoxin [iron-sulfur] cluster" cannot be used as a page name in this wiki.