Difference between revisions of "O-UREIDOHOMOSERINE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-21_002340 == * left end position: ** 3366098 * transcription direction: ** NEGATIVE * right end position: ** 3375230 * centisome position: ** 45.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == * smiles: ** C(CC(C(=O)[O-])[N+])ONC(N)=O * inchi key...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(CC(C(=O)[O-])[N+])ONC(N)=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N |
| − | * | + | * common name: |
| − | ** | + | ** O-ureidohomoserine |
| − | * | + | * molecular weight: |
| − | ** | + | ** 177.16 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-10]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-9]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820483 91820483] |
| − | {{#set: | + | * HMDB : HMDB12271 |
| − | {{#set: | + | {{#set: smiles=C(CC(C(=O)[O-])[N+])ONC(N)=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N}} |
| − | {{#set: | + | {{#set: common name=O-ureidohomoserine}} |
| + | {{#set: molecular weight=177.16 }} | ||
| + | {{#set: consumed by=RXN-10}} | ||
| + | {{#set: produced by=RXN-9}} | ||
Latest revision as of 20:52, 21 March 2018
Contents
Metabolite O-UREIDOHOMOSERINE
- smiles:
- C(CC(C(=O)[O-])[N+])ONC(N)=O
- inchi key:
- InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N
- common name:
- O-ureidohomoserine
- molecular weight:
- 177.16
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12271
"C(CC(C(=O)[O-])[N+])ONC(N)=O" cannot be used as a page name in this wiki.
