Difference between revisions of "RXN-14812"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11528 CPD-11528] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14812 RXN-14812] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11528 CPD-11528] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14812 RXN-14812] ==
−
* smiles:
+
* direction:
−
** CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J
+
−
* common name:
+
−
** OPC4-3-ketoacyl-CoA
+
−
* molecular weight:
+
−
** 997.797   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-10703]]
+
** 1 [[CPD-15709]][c] '''<=>''' 1 [[FRUCTOSE-6P]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 D-fructose 6-phosphate[c] '''<=>''' 1 &beta;-D-fructofuranose 6-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237346 44237346]
+
{{#set: in pathway=}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=OPC4-3-ketoacyl-CoA}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=997.797    }}
+
−
{{#set: produced by=RXN-10703}}
+

Latest revision as of 20:52, 21 March 2018

Reaction RXN-14812

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 D-fructose 6-phosphate[c] <=> 1 β-D-fructofuranose 6-phosphate[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14812&oldid=29897"