Difference between revisions of "CPD-3762"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) * inchi key: ** InChIKey=SXZYCX...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3762 CPD-3762] == * smiles: ** C1(=NC(C(N)=O)C(N)=N1) * inchi key: ** InChIKey=PYNDTGFTPOZG...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3762 CPD-3762] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(=NC(C(N)=O)C(N)=N1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PYNDTGFTPOZGRW-UHFFFAOYSA-N |
* common name: | * common name: | ||
− | ** | + | ** 5-amino-4-imidazolecarboxyamide |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 126.118 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 1H-imidazole-4-carboxamide, 5-amino- |
− | ** | + | ** 5(4)-amino-4(5)-imidazolecarboxamide |
− | ** | + | ** 5-aminoimidazole-4-carboxamide |
− | ** | + | ** 4-amino-5-carbamoylimidazole |
+ | ** 4-amino-5-imidazolecarboxamide | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[RXN-14270]] |
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04051 C04051] |
− | {{#set: smiles= | + | * CHEBI: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2030 2030] |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: molecular weight= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202832 25202832] |
− | {{#set: common name= | + | * HMDB : HMDB03192 |
− | + | {{#set: smiles=C1(=NC(C(N)=O)C(N)=N1)}} | |
− | {{#set: reversible reaction associated=RXN- | + | {{#set: inchi key=InChIKey=PYNDTGFTPOZGRW-UHFFFAOYSA-N}} |
+ | {{#set: common name=5-amino-4-imidazolecarboxyamide}} | ||
+ | {{#set: molecular weight=126.118 }} | ||
+ | {{#set: common name=1H-imidazole-4-carboxamide, 5-amino-|5(4)-amino-4(5)-imidazolecarboxamide|5-aminoimidazole-4-carboxamide|4-amino-5-carbamoylimidazole|4-amino-5-imidazolecarboxamide}} | ||
+ | {{#set: reversible reaction associated=RXN-14270}} |
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite CPD-3762
- smiles:
- C1(=NC(C(N)=O)C(N)=N1)
- inchi key:
- InChIKey=PYNDTGFTPOZGRW-UHFFFAOYSA-N
- common name:
- 5-amino-4-imidazolecarboxyamide
- molecular weight:
- 126.118
- Synonym(s):
- 1H-imidazole-4-carboxamide, 5-amino-
- 5(4)-amino-4(5)-imidazolecarboxamide
- 5-aminoimidazole-4-carboxamide
- 4-amino-5-carbamoylimidazole
- 4-amino-5-imidazolecarboxamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links