Difference between revisions of "O-phospho-L-seryl-tRNASecs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TDP TDP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])[O-])O2)) * in...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-phospho-L-seryl-tRNASecs O-phospho-L-seryl-tRNASecs] == * common name: ** an O-phospho-L-sery...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TDP TDP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-phospho-L-seryl-tRNASecs O-phospho-L-seryl-tRNASecs] ==
−
* smiles:
+
−
** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])[O-])O2))
+
−
* inchi key:
+
−
** InChIKey=UJLXYODCHAELLY-XLPZGREQSA-K
+
 
* common name:
 
* common name:
−
** dTDP
+
** an O-phospho-L-seryl-[tRNASec]
−
* molecular weight:
+
−
** 399.167   
+
 
* Synonym(s):
 
* Synonym(s):
−
** TDP
+
** an O-phosphoseryl-[tRNAsec]
−
** thymidine 5'-(trihydrogen diphosphate) (9CI)
+
** an O-phosphoseryl-tRNA[Ser]Sec
−
** deoxy-TDP
+
** an O-phosphoseryl-[tRNA(Sec)]
−
** thymidine-5'-diphosphate
+
−
** thymidine-diphosphate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[DTDPKIN-RXN]]
+
* [[RXN-10039]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[DTMPKI-RXN]]
 
−
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-14213]]
+
* [[RXN-10038]]
 
== External links  ==
 
== External links  ==
−
* CAS : 491-97-4
+
{{#set: common name=an O-phospho-L-seryl-[tRNASec]}}
−
* BIGG : 34750
+
{{#set: common name=an O-phosphoseryl-[tRNAsec]|an O-phosphoseryl-tRNA[Ser]Sec|an O-phosphoseryl-[tRNA(Sec)]}}
−
* PUBCHEM:
+
{{#set: consumed by=RXN-10039}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21124327 21124327]
+
{{#set: reversible reaction associated=RXN-10038}}
−
* HMDB : HMDB01274
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00363 C00363]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.19989845.html 19989845]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58369 58369]
+
−
* METABOLIGHTS : MTBLC58369
+
−
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])[O-])O2))}}
+
−
{{#set: inchi key=InChIKey=UJLXYODCHAELLY-XLPZGREQSA-K}}
+
−
{{#set: common name=dTDP}}
+
−
{{#set: molecular weight=399.167    }}
+
−
{{#set: common name=TDP|thymidine 5'-(trihydrogen diphosphate) (9CI)|deoxy-TDP|thymidine-5'-diphosphate|thymidine-diphosphate}}
+
−
{{#set: consumed by=DTDPKIN-RXN}}
+
−
{{#set: produced by=DTMPKI-RXN|THYMIDINE-TRIPHOSPHATASE-RXN}}
+
−
{{#set: reversible reaction associated=RXN-14213}}
+

Latest revision as of 19:52, 21 March 2018

Metabolite O-phospho-L-seryl-tRNASecs

  • common name:
    • an O-phospho-L-seryl-[tRNASec]
  • Synonym(s):
    • an O-phosphoseryl-[tRNAsec]
    • an O-phosphoseryl-tRNA[Ser]Sec
    • an O-phosphoseryl-[tRNA(Sec)]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an O-phospho-L-seryl-[tRNASec" cannot be used as a page name in this wiki.
  • "an O-phosphoseryl-[tRNAsec" cannot be used as a page name in this wiki.
  • "an O-phosphoseryl-tRNA[Ser]Sec" cannot be used as a page name in this wiki.
  • "an O-phosphoseryl-[tRNA(Sec)" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=O-phospho-L-seryl-tRNASecs&oldid=29951"