Difference between revisions of "Ec-01 009800"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == * smiles: ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(...")
(Created page with "Category:Gene == Gene Ec-01_009800 == * left end position: ** 8287451 * transcription direction: ** POSITIVE * right end position: ** 8287991 * centisome position: ** 80.3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] ==
+
== Gene Ec-01_009800 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
+
** 8287451
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** apo-4'-lycopenal
+
** 8287991
−
* molecular weight:
+
* centisome position:
−
** 482.748    
+
** 80.313835    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0277_0009
 +
** Esi0277_0009
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
* [[RXN-11999]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=8287451}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986183 50986183]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O}}
+
{{#set: right end position=8287991}}
−
{{#set: inchi key=InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N}}
+
{{#set: centisome position=80.313835    }}
−
{{#set: common name=apo-4'-lycopenal}}
+
{{#set: common name=Esi_0277_0009|Esi0277_0009}}
−
{{#set: molecular weight=482.748    }}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: produced by=RXN-11999}}
+

Latest revision as of 19:52, 21 March 2018

Gene Ec-01_009800

  • left end position:
    • 8287451
  • transcription direction:
    • POSITIVE
  • right end position:
    • 8287991
  • centisome position:
    • 80.313835
  • Synonym(s):
    • Esi_0277_0009
    • Esi0277_0009

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_009800&oldid=29968"