Difference between revisions of "Ec-27 000390"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...")
(Created page with "Category:Gene == Gene Ec-27_000390 == * left end position: ** 271653 * transcription direction: ** POSITIVE * right end position: ** 278407 * centisome position: ** 4.2117...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] ==
+
== Gene Ec-27_000390 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** 271653
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 14-hydroxylanosterol
+
** 278407
−
* molecular weight:
+
* centisome position:
−
** 442.724    
+
** 4.211735    
 
* Synonym(s):
 
* Synonym(s):
−
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
+
** Esi_0122_0054
 +
** Esi0122_0054
 +
** mGST
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-304]]
+
* Reaction: [[GSHTRAN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN66-303]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
 +
* Reaction: [[GST-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13673]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15680]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=271653}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: right end position=278407}}
−
{{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}}
+
{{#set: centisome position=4.211735   }}
−
{{#set: common name=14-hydroxylanosterol}}
+
{{#set: common name=Esi_0122_0054|Esi0122_0054|mGST}}
−
{{#set: molecular weight=442.724   }}
+
{{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
−
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
−
{{#set: consumed by=RXN66-304}}
+
−
{{#set: produced by=RXN66-303}}
+

Latest revision as of 19:53, 21 March 2018

Gene Ec-27_000390

  • left end position:
    • 271653
  • transcription direction:
    • POSITIVE
  • right end position:
    • 278407
  • centisome position:
    • 4.211735
  • Synonym(s):
    • Esi_0122_0054
    • Esi0122_0054
    • mGST

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_000390&oldid=29994"