Difference between revisions of "Ec-02 001740"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THREO-DS-ISO-CITRATE THREO-DS-ISO-CITRATE] == * smiles: ** C(=O)(C(CC([O-])=O)C(O)C([O-])=O)[O-...")
(Created page with "Category:Gene == Gene Ec-02_001740 == * left end position: ** 2056185 * transcription direction: ** NEGATIVE * right end position: ** 2061999 * centisome position: ** 31.4...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THREO-DS-ISO-CITRATE THREO-DS-ISO-CITRATE] ==
+
== Gene Ec-02_001740 ==
−
* smiles:
+
* left end position:
−
** C(=O)(C(CC([O-])=O)C(O)C([O-])=O)[O-]
+
** 2056185
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ODBLHEXUDAPZAU-ZAFYKAAXSA-K
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** D-threo-isocitrate
+
** 2061999
−
* molecular weight:
+
* centisome position:
−
** 189.101    
+
** 31.498941    
 
* Synonym(s):
 
* Synonym(s):
−
** D-threo-isocitrate
+
** Esi_0055_0060
−
** (1R, 2S)-1-hydroxypropane-1,2,3-tricarboxylate
+
** Esi0055_0060
−
** D-threo-isocitric acid
+
** APX
−
** isocitric acid
+
−
** isocitrate
+
−
** threo-Ds-isocitrate
+
−
** I-CIT
+
−
** D-isocitrate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[biomass_rxn]]
+
* Reaction: [[PEROXID-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
−
* [[ACONITATEHYDR-RXN]]
+
* Reaction: [[RXN-12440]]
−
* [[ISOCITDEH-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-14047]]
+
*** Assignment: ec-number
−
* [[ISOCIT-CLEAV-RXN]]
+
* Reaction: [[RXN-14240]]
−
* [[RXN-9951]]
+
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-15288]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-17352]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-3521]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-8635]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7214]]
 +
* [[PWY-6824]]
 +
* [[PWY-6960]]
 +
* [[PWY-5461]]
 +
* [[PWY-7445]]
 +
* [[PWY-5469]]
 +
* [[PWY-5466]]
 +
* [[PWY-6959]]
 +
* [[PWY-6961]]
 +
* [[PWY-2261]]
 
== External links  ==
 
== External links  ==
−
* CAS : 320-77-4
+
{{#set: left end position=2056185}}
−
* CAS : 30810-51-6
+
{{#set: transcription direction=NEGATIVE}}
−
* BIGG : 34579
+
{{#set: right end position=2061999}}
−
* PUBCHEM:
+
{{#set: centisome position=31.498941   }}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459771 5459771]
+
{{#set: common name=Esi_0055_0060|Esi0055_0060|APX}}
−
* KNAPSACK : C00001188
+
{{#set: reaction associated=PEROXID-RXN|RXN-12440|RXN-14240|RXN-15288|RXN-17352|RXN-3521|RXN-8635}}
−
* HMDB : HMDB01874
+
{{#set: pathway associated=PWY-7214|PWY-6824|PWY-6960|PWY-5461|PWY-7445|PWY-5469|PWY-5466|PWY-6959|PWY-6961|PWY-2261}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00451 C00451]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573553.html 4573553]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15562 15562]
+
−
* METABOLIGHTS : MTBLC15562
+
−
{{#set: smiles=C(=O)(C(CC([O-])=O)C(O)C([O-])=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=ODBLHEXUDAPZAU-ZAFYKAAXSA-K}}
+
−
{{#set: common name=D-threo-isocitrate}}
+
−
{{#set: molecular weight=189.101   }}
+
−
{{#set: common name=D-threo-isocitrate|(1R, 2S)-1-hydroxypropane-1,2,3-tricarboxylate|D-threo-isocitric acid|isocitric acid|isocitrate|threo-Ds-isocitrate|I-CIT|D-isocitrate}}
+
−
{{#set: consumed by=biomass_rxn}}
+
−
{{#set: reversible reaction associated=ACONITATEHYDR-RXN|ISOCITDEH-RXN|RXN-14047|ISOCIT-CLEAV-RXN|RXN-9951}}
+

Latest revision as of 20:53, 21 March 2018

Gene Ec-02_001740

  • left end position:
    • 2056185
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2061999
  • centisome position:
    • 31.498941
  • Synonym(s):
    • Esi_0055_0060
    • Esi0055_0060
    • APX

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-02_001740&oldid=30052"