Difference between revisions of "Ec-10 002950"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...")
(Created page with "Category:Gene == Gene Ec-10_002950 == * left end position: ** 3023280 * transcription direction: ** POSITIVE * right end position: ** 3032739 * centisome position: ** 46.5...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] ==
+
== Gene Ec-10_002950 ==
−
* smiles:
+
* left end position:
−
** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
+
** 3023280
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** salicyl-6-hydroxy-2-cyclohexene-on-oyl
+
** 3032739
−
* molecular weight:
+
* centisome position:
−
** 262.262    
+
** 46.504955    
 
* Synonym(s):
 
* Synonym(s):
−
** salicyl-HCH
+
** Esi_0174_0057
−
** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
+
** Esi0174_0057
−
** acylsaligenin
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12252]]
+
* Reaction: [[RIBOFLAVINKIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY66-366]]
 +
* [[PWY-6168]]
 +
* [[RIBOSYN2-PWY]]
 +
* [[PWY-5523]]
 
== External links  ==
 
== External links  ==
−
* CAS : 529507-98-0
+
{{#set: left end position=3023280}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723]
+
{{#set: right end position=3032739}}
−
{{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}}
+
{{#set: centisome position=46.504955   }}
−
{{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}}
+
{{#set: common name=Esi_0174_0057|Esi0174_0057}}
−
{{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}}
+
{{#set: reaction associated=RIBOFLAVINKIN-RXN}}
−
{{#set: molecular weight=262.262   }}
+
{{#set: pathway associated=PWY66-366|PWY-6168|RIBOSYN2-PWY|PWY-5523}}
−
{{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}}
+
−
{{#set: consumed by=RXN-12252}}
+

Latest revision as of 19:53, 21 March 2018

Gene Ec-10_002950

  • left end position:
    • 3023280
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3032739
  • centisome position:
    • 46.504955
  • Synonym(s):
    • Esi_0174_0057
    • Esi0174_0057

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_002950&oldid=30060"