Difference between revisions of "Ec-02 000590"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == * smiles: ** C(SCC(C([O-])=O)[N+])CC([N+])C([O-])=O * inchi...") |
(Created page with "Category:Gene == Gene Ec-02_000590 == * left end position: ** 650592 * transcription direction: ** NEGATIVE * right end position: ** 653742 * centisome position: ** 9.9664...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_000590 == |
− | * | + | * left end position: |
− | ** | + | ** 650592 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 653742 |
− | * | + | * centisome position: |
− | ** | + | ** 9.9664955 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0040_0141 |
+ | ** Esi0040_0141 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[6.3.2.25-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
− | + | ||
− | * | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=650592}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=653742}} | |
− | + | {{#set: centisome position=9.9664955 }} | |
− | + | {{#set: common name=Esi_0040_0141|Esi0040_0141}} | |
− | + | {{#set: reaction associated=6.3.2.25-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 19:53, 21 March 2018
Gene Ec-02_000590
- left end position:
- 650592
- transcription direction:
- NEGATIVE
- right end position:
- 653742
- centisome position:
- 9.9664955
- Synonym(s):
- Esi_0040_0141
- Esi0040_0141
Reactions associated
- Reaction: 6.3.2.25-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome