Difference between revisions of "CPD-13713"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14796 RXN-14796] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-CoA oxidase, partial *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == * smiles: ** C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14796 RXN-14796] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))
 +
* inchi key:
 +
** InChIKey=XCADVMZZFPIERR-DEGSGYPDSA-M
 
* common name:
 
* common name:
−
** acyl-CoA oxidase, partial
+
** adenosine 5'-phosphoselenate
−
** Acyl-CoA oxidase/dehydrogenase, central domain
+
* molecular weight:
−
** acyl-CoA oxidase
+
** 473.174   
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** adenylyl-selenate
 +
** APSe
 +
** adenosine phosphoselenate
 +
** adenylylselenate
 +
** adenosine-5'-phosphoselenate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-15684]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[CPD-15685]][c]
+
* [[RXN-12720]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 oxygen[c] '''+''' 1 5-cis, 7-trans-tetradecadienoyl-CoA[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-26_004320]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Ec-22_002920]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Ec-08_006390]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-7340]], 9-cis, 11-trans-octadecadienoyl-CoA degradation (isomerase-dependent, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7340 PWY-7340]
+
−
** '''1''' reactions found over '''10''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=acyl-CoA oxidase, partial}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657723 90657723]
−
{{#set: common name=Acyl-CoA oxidase/dehydrogenase, central domain}}
+
* CHEBI:
−
{{#set: common name=acyl-CoA oxidase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2485 2485]
−
{{#set: ec number=EC-1.3.3.6}}
+
* LIGAND-CPD:
−
{{#set: gene associated=Ec-26_004320|Ec-22_002920|Ec-08_006390}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05686 C05686]
−
{{#set: in pathway=PWY-7340}}
+
* HMDB : HMDB04112
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: inchi key=InChIKey=XCADVMZZFPIERR-DEGSGYPDSA-M}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=adenosine 5'-phosphoselenate}}
 +
{{#set: molecular weight=473.174    }}
 +
{{#set: common name=adenylyl-selenate|APSe|adenosine phosphoselenate|adenylylselenate|adenosine-5'-phosphoselenate}}
 +
{{#set: produced by=RXN-12720}}

Latest revision as of 20:54, 21 March 2018

Metabolite CPD-13713

  • smiles:
    • C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))
  • inchi key:
    • InChIKey=XCADVMZZFPIERR-DEGSGYPDSA-M
  • common name:
    • adenosine 5'-phosphoselenate
  • molecular weight:
    • 473.174
  • Synonym(s):
    • adenylyl-selenate
    • APSe
    • adenosine phosphoselenate
    • adenylylselenate
    • adenosine-5'-phosphoselenate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-13713&oldid=30157"