Difference between revisions of "Monocarboxylates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Monocarboxylates Monocarboxylates] == * common name: ** a monocarboxylate * Synonym(s): == Rea...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Monocarboxylates Monocarboxylates] ==
* smiles:
+
** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
+
* inchi key:
+
** InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L
+
 
* common name:
 
* common name:
** betanidin
+
** a monocarboxylate
* molecular weight:
+
** 386.317   
+
 
* Synonym(s):
 
* Synonym(s):
** betanidin radical
 
** 2,6-Pyridinedicarboxylic acid
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8635]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[AMIDASE-RXN]]
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB00217
+
{{#set: common name=a monocarboxylate}}
* PUBCHEM:
+
{{#set: reversible reaction associated=AMIDASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245506 25245506]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3079 3079]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C08539 C08539]
+
* HMDB : HMDB29407
+
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
+
{{#set: inchi key=InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L}}
+
{{#set: common name=betanidin}}
+
{{#set: molecular weight=386.317    }}
+
{{#set: common name=betanidin radical|2,6-Pyridinedicarboxylic acid}}
+
{{#set: consumed by=RXN-8635}}
+

Latest revision as of 20:54, 21 March 2018

Metabolite Monocarboxylates

  • common name:
    • a monocarboxylate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links