Difference between revisions of "CPD-12852"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_000870 == * Synonym(s): ** Esi_0029_0138 ** Esi0029_0138 == Reactions associated == * Reaction: RXN-4726 ** Source: orthology-aragem *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N | ||
| + | * common name: | ||
| + | ** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol | ||
| + | * molecular weight: | ||
| + | ** 412.698 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 5α-cholesta-8,24-dien-3β-ol |
| − | ** | + | ** 4α,14α-dimethylzymosterol |
| + | ** 29-norlanosterol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-11881]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986191 50986191] |
| − | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} |
| + | {{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}} | ||
| + | {{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol}} | ||
| + | {{#set: molecular weight=412.698 }} | ||
| + | {{#set: common name=5α-cholesta-8,24-dien-3β-ol|4α,14α-dimethylzymosterol|29-norlanosterol}} | ||
| + | {{#set: consumed by=RXN-11881}} | ||
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD-12852
- smiles:
- CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
- common name:
- 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
- molecular weight:
- 412.698
- Synonym(s):
- 5α-cholesta-8,24-dien-3β-ol
- 4α,14α-dimethylzymosterol
- 29-norlanosterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
