Difference between revisions of "Ec-05 005340"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-] * inchi key: ** InChI...")
(Created page with "Category:Gene == Gene Ec-05_005340 == * left end position: ** 7266099 * transcription direction: ** NEGATIVE * right end position: ** 7275933 * centisome position: ** 79.8...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] ==
+
== Gene Ec-05_005340 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]
+
** 7266099
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** docosahexaenoate
+
** 7275933
−
* molecular weight:
+
* centisome position:
−
** 327.486    
+
** 79.816505    
 
* Synonym(s):
 
* Synonym(s):
−
** docosahexaenoic acid
+
** Esi_0152_0022
−
** DHA
+
** Esi0152_0022
−
** all-cis-docosa-4,7,10,13,16,19-hexaenoate
+
−
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate
+
−
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
−
* [[RXN-16138]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7210]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7184]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMFA01030185
+
{{#set: left end position=7266099}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40486925 40486925]
+
{{#set: right end position=7275933}}
−
* DRUGBANK : DB03756
+
{{#set: centisome position=79.816505   }}
−
* CHEBI:
+
{{#set: common name=Esi_0152_0022|Esi0152_0022}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77016 77016]
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
* HMDB : HMDB02183
+
{{#set: pathway associated=PWY-7210|PWY-7198|PWY-6545|PWY-7184}}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M}}
+
−
{{#set: common name=docosahexaenoate}}
+
−
{{#set: molecular weight=327.486   }}
+
−
{{#set: common name=docosahexaenoic acid|DHA|all-cis-docosa-4,7,10,13,16,19-hexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate}}
+
−
{{#set: produced by=RXN-16138}}
+

Latest revision as of 19:54, 21 March 2018

Gene Ec-05_005340

  • left end position:
    • 7266099
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 7275933
  • centisome position:
    • 79.816505
  • Synonym(s):
    • Esi_0152_0022
    • Esi0152_0022

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_005340&oldid=30176"