Difference between revisions of "Ec-26 000350"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)...")
(Created page with "Category:Gene == Gene Ec-26_000350 == * Synonym(s): ** Esi_0079_0042 ** Esi0079_0042 == Reactions associated == * Reaction: RXN-1404 ** Source: orthology-aragem =...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] ==
+
== Gene Ec-26_000350 ==
−
* smiles:
+
−
** C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
+
−
* inchi key:
+
−
** InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
+
−
* common name:
+
−
** 2-hydroxy-dATP
+
−
* molecular weight:
+
−
** 503.152   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-hydroxydeoxyadenosine 5'-triphosphate
+
** Esi_0079_0042
−
** 2'-deoxyisoguanosine triphosphate
+
** Esi0079_0042
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-1404]]
−
* [[RXN-14290]]
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-581]]
 +
* [[PWY-5026]]
 +
* [[PWYQT-4476]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=Esi_0079_0042|Esi0079_0042}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289402 86289402]
+
{{#set: reaction associated=RXN-1404}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-581|PWY-5026|PWYQT-4476}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77897 77897]
+
−
{{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}}
+
−
{{#set: inchi key=InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J}}
+
−
{{#set: common name=2-hydroxy-dATP}}
+
−
{{#set: molecular weight=503.152    }}
+
−
{{#set: common name=2-hydroxydeoxyadenosine 5'-triphosphate|2'-deoxyisoguanosine triphosphate}}
+
−
{{#set: produced by=RXN-14290}}
+

Latest revision as of 19:54, 21 March 2018

Gene Ec-26_000350

  • Synonym(s):
    • Esi_0079_0042
    • Esi0079_0042

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_000350&oldid=30179"