Difference between revisions of "CPD-8653"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-23_001400 == * left end position: ** 1470905 * transcription direction: ** NEGATIVE * right end position: ** 1478516 * centisome position: ** 30.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L |
| − | * | + | * common name: |
| − | ** | + | ** betanidin |
| − | * | + | * molecular weight: |
| − | ** | + | ** 386.317 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** betanidin radical |
| − | ** | + | ** 2,6-Pyridinedicarboxylic acid |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-8635]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * DRUGBANK : DB00217 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245506 25245506] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3079 3079] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C08539 C08539] | ||
| + | * HMDB : HMDB29407 | ||
| + | {{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}} | ||
| + | {{#set: inchi key=InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L}} | ||
| + | {{#set: common name=betanidin}} | ||
| + | {{#set: molecular weight=386.317 }} | ||
| + | {{#set: common name=betanidin radical|2,6-Pyridinedicarboxylic acid}} | ||
| + | {{#set: consumed by=RXN-8635}} | ||
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD-8653
- smiles:
- C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
- inchi key:
- InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L
- common name:
- betanidin
- molecular weight:
- 386.317
- Synonym(s):
- betanidin radical
- 2,6-Pyridinedicarboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)" cannot be used as a page name in this wiki.
