Difference between revisions of "CPD-3481"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-15_002870 == * left end position: ** 3087197 * transcription direction: ** NEGATIVE * right end position: ** 3097755 * centisome position: ** 57.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == * smiles: ** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InChI...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O |
| − | * | + | * common name: |
| − | ** | + | ** bupropion |
| − | * | + | * molecular weight: |
| − | ** | + | ** 240.752 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (-)-2-(tert-butylamino)-3'-chloropropiophenone |
| − | ** | + | ** 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)- |
| + | ** (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone | ||
| + | ** amfebutamonum | ||
| + | ** α-(tert-butylamino)-m-chloropropiophenone | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN66-181]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * DRUGBANK : DB01156 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24849133 24849133] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3219 3219] |
| − | + | * LIGAND-CPD: | |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06860 C06860] |
| + | * HMDB : HMDB01510 | ||
| + | {{#set: smiles=CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)}} | ||
| + | {{#set: inchi key=InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O}} | ||
| + | {{#set: common name=bupropion}} | ||
| + | {{#set: molecular weight=240.752 }} | ||
| + | {{#set: common name=(-)-2-(tert-butylamino)-3'-chloropropiophenone|1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-|(+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone|amfebutamonum|α-(tert-butylamino)-m-chloropropiophenone}} | ||
| + | {{#set: consumed by=RXN66-181}} | ||
Latest revision as of 20:54, 21 March 2018
Contents
Metabolite CPD-3481
- smiles:
- CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)
- inchi key:
- InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O
- common name:
- bupropion
- molecular weight:
- 240.752
- Synonym(s):
- (-)-2-(tert-butylamino)-3'-chloropropiophenone
- 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-
- (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone
- amfebutamonum
- α-(tert-butylamino)-m-chloropropiophenone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)" cannot be used as a page name in this wiki.
