Difference between revisions of "RXN-16136"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16136 RXN-16136] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16136 RXN-16136] ==
−
* smiles:
+
* direction:
−
** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N
+
** [http://enzyme.expasy.org/EC/1.1.1 EC-1.1.1]
−
* common name:
+
−
** 4α-hydroxy-tetrahydrobiopterin
+
−
* molecular weight:
+
−
** 257.249   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4α-hydroxy-5,6,7,8-tetrahydrobiopterin
 
−
** 4α-hydroxy-tetrahydropterin
 
−
** 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7908]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[CPD-17387]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[CPD-17388]][c]
−
* [[RXN66-569]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NAD+[c] '''+''' 1 (3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA[c] '''=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7606]], docosahexaenoate biosynthesis III (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606]
 +
** '''14''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657593 90657593]
+
{{#set: ec number=EC-1.1.1}}
−
* CHEBI:
+
{{#set: in pathway=PWY-7606}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15374 15374]
+
{{#set: reconstruction category=annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15522 C15522]
+
{{#set: reconstruction tool=pathwaytools}}
−
* HMDB : HMDB02281
+
−
{{#set: smiles=CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))}}
+
−
{{#set: inchi key=InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N}}
+
−
{{#set: common name=4α-hydroxy-tetrahydrobiopterin}}
+
−
{{#set: molecular weight=257.249    }}
+
−
{{#set: common name=4α-hydroxy-5,6,7,8-tetrahydrobiopterin|4α-hydroxy-tetrahydropterin|6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin}}
+
−
{{#set: consumed by=RXN-7908}}
+
−
{{#set: produced by=RXN66-569}}
+

Latest revision as of 20:55, 21 March 2018

Reaction RXN-16136

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 (3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA[c] => 1 H+[c] + 1 NADH[c] + 1 3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA[c]

Genes associated with this reaction

Pathways

  • PWY-7606, docosahexaenoate biosynthesis III (6-desaturase, mammals): PWY-7606
    • 14 reactions found over 14 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-16136&oldid=30260"