Difference between revisions of "CPD-5881"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.7.14-RXN 2.7.7.14-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Rossmann-like alpha/b...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * inchi key: **...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.7.14-RXN 2.7.7.14-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))
 +
* inchi key:
 +
** InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N
 
* common name:
 
* common name:
−
** Rossmann-like alpha/beta/alpha sandwich fold
+
** 4α-hydroxy-tetrahydrobiopterin
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.7.14 EC-2.7.7.14]
+
** 257.249   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4α-hydroxy-5,6,7,8-tetrahydrobiopterin
 +
** 4α-hydroxy-tetrahydropterin
 +
** 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7908]]
−
** 1 [[PROTON]][c] '''+''' 1 [[PHOSPHORYL-ETHANOLAMINE]][c] '''+''' 1 [[CTP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CDP-ETHANOLAMINE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-569]]
−
** 1 H+[c] '''+''' 1 O-phosphoethanolamine[c] '''+''' 1 CTP[c] '''=>''' 1 diphosphate[c] '''+''' 1 CDP-ethanolamine[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-07_004830]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-7782]], plasmalogen biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7782 PWY-7782]
+
−
** '''6''' reactions found over '''16''' reactions in the full pathway
+
−
* [[PWY4FS-6]], phosphatidylethanolamine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-6 PWY4FS-6]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24592 24592]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657593 90657593]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R02038 R02038]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15374 15374]
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P33412 P33412]
+
** [http://www.genome.jp/dbget-bin/www_bget?C15522 C15522]
−
** [http://www.uniprot.org/uniprot/Q9UTI6 Q9UTI6]
+
* HMDB : HMDB02281
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))}}
−
{{#set: common name=Rossmann-like alpha/beta/alpha sandwich fold}}
+
{{#set: inchi key=InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N}}
−
{{#set: ec number=EC-2.7.7.14}}
+
{{#set: common name=4α-hydroxy-tetrahydrobiopterin}}
−
{{#set: gene associated=Ec-07_004830}}
+
{{#set: molecular weight=257.249    }}
−
{{#set: in pathway=PWY-7782|PWY4FS-6}}
+
{{#set: common name=4α-hydroxy-5,6,7,8-tetrahydrobiopterin|4α-hydroxy-tetrahydropterin|6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin}}
−
{{#set: reconstruction category=orthology|annotation}}
+
{{#set: consumed by=RXN-7908}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
{{#set: produced by=RXN66-569}}
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 20:55, 21 March 2018

Metabolite CPD-5881

  • smiles:
    • CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))
  • inchi key:
    • InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N
  • common name:
    • 4α-hydroxy-tetrahydrobiopterin
  • molecular weight:
    • 257.249
  • Synonym(s):
    • 4α-hydroxy-5,6,7,8-tetrahydrobiopterin
    • 4α-hydroxy-tetrahydropterin
    • 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-5881&oldid=30274"