Difference between revisions of "CPD-6994"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-HYDROXY-PHENYLPYRUVATE P-HYDROXY-PHENYLPYRUVATE] == * smiles: ** C1(C(CC(C([O-])=O)=O)=CC=C(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * in...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == |
* smiles: | * smiles: | ||
− | ** | + | ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M |
* common name: | * common name: | ||
− | ** | + | ** (2S)-eriodictyol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 287.248 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7775]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657147 90657147] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28412 28412] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05631 C05631] |
− | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB05810 |
− | {{#set: common name= | + | {{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M}} |
− | + | {{#set: common name=(2S)-eriodictyol}} | |
− | {{#set: consumed by= | + | {{#set: molecular weight=287.248 }} |
− | + | {{#set: consumed by=RXN-7775}} | |
− | + |
Latest revision as of 19:56, 21 March 2018
Contents
Metabolite CPD-6994
- smiles:
- C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)
- inchi key:
- InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M
- common name:
- (2S)-eriodictyol
- molecular weight:
- 287.248
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)" cannot be used as a page name in this wiki.