Difference between revisions of "DIHYDROPTERIN-CH2OH-PP"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17789 RXN-17789] == * direction: ** LEFT-TO-RIGHT * common name: ** enoyl-Coenzyme A hydratase/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROPTERIN-CH2OH-PP DIHYDROPTERIN-CH2OH-PP] == * smiles: ** C2(C(COP(=O)([O-])OP(=O)([O-])[O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROPTERIN-CH2OH-PP DIHYDROPTERIN-CH2OH-PP] == |
− | * | + | * smiles: |
− | ** | + | ** C2(C(COP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2)) |
+ | * inchi key: | ||
+ | ** InChIKey=FCQGJGLSOWZZON-UHFFFAOYSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** (7,8-dihydropterin-6-yl)methyl diphosphate |
− | + | * molecular weight: | |
− | * | + | ** 352.116 |
− | + | ||
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 6-hydroxymethyl-dihydropterin pyrophosphate | ||
+ | ** 6-hydroxymethyl-dihydropterin diphosphate | ||
+ | ** 6-hydroxymethyl-7,8-dihydropterin diphosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[H2PTEROATESYNTH-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[H2PTERIDINEPYROPHOSPHOKIN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244074 25244074] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73083 73083] |
− | {{#set: | + | * BIGG : 1447078 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04807 C04807] |
− | + | {{#set: smiles=C2(C(COP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))}} | |
− | + | {{#set: inchi key=InChIKey=FCQGJGLSOWZZON-UHFFFAOYSA-K}} | |
− | {{#set: | + | {{#set: common name=(7,8-dihydropterin-6-yl)methyl diphosphate}} |
+ | {{#set: molecular weight=352.116 }} | ||
+ | {{#set: common name=6-hydroxymethyl-dihydropterin pyrophosphate|6-hydroxymethyl-dihydropterin diphosphate|6-hydroxymethyl-7,8-dihydropterin diphosphate}} | ||
+ | {{#set: consumed by=H2PTEROATESYNTH-RXN}} | ||
+ | {{#set: produced by=H2PTERIDINEPYROPHOSPHOKIN-RXN}} |
Latest revision as of 19:56, 21 March 2018
Contents
Metabolite DIHYDROPTERIN-CH2OH-PP
- smiles:
- C2(C(COP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))
- inchi key:
- InChIKey=FCQGJGLSOWZZON-UHFFFAOYSA-K
- common name:
- (7,8-dihydropterin-6-yl)methyl diphosphate
- molecular weight:
- 352.116
- Synonym(s):
- 6-hydroxymethyl-dihydropterin pyrophosphate
- 6-hydroxymethyl-dihydropterin diphosphate
- 6-hydroxymethyl-7,8-dihydropterin diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2(C(COP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))" cannot be used as a page name in this wiki.