Difference between revisions of "Ec-26 005140"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == * smiles: ** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
(Created page with "Category:Gene == Gene Ec-26_005140 == * left end position: ** 5232976 * transcription direction: ** POSITIVE * right end position: ** 5244255 * centisome position: ** 79.4...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] ==
+
== Gene Ec-26_005140 ==
−
* smiles:
+
* left end position:
−
** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)
+
** 5232976
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** XLLG xyloglucan oligosaccharide
+
** 5244255
−
* molecular weight:
+
* centisome position:
−
** 1387.215    
+
** 79.48807    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0103_0085
 +
** Esi0103_0085
 +
** CDPK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12400]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5232976}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940189 52940189]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)}}
+
{{#set: right end position=5244255}}
−
{{#set: inchi key=InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N}}
+
{{#set: centisome position=79.48807    }}
−
{{#set: common name=XLLG xyloglucan oligosaccharide}}
+
{{#set: common name=Esi_0103_0085|Esi0103_0085|CDPK}}
−
{{#set: molecular weight=1387.215    }}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: consumed by=RXN-12400}}
+

Latest revision as of 19:56, 21 March 2018

Gene Ec-26_005140

  • left end position:
    • 5232976
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5244255
  • centisome position:
    • 79.48807
  • Synonym(s):
    • Esi_0103_0085
    • Esi0103_0085
    • CDPK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_005140&oldid=30432"