Difference between revisions of "CPD-12481"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-25_001080 == * left end position: ** 1309712 * transcription direction: ** NEGATIVE * right end position: ** 1319620 * centisome position: ** 29.4...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * inchi key: ** InChIKey=Y...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-25_001080 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] ==
* left end position:
+
* smiles:
** 1309712
+
** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
* right end position:
+
* common name:
** 1319620
+
** 7-methylurate
* centisome position:
+
* molecular weight:
** 29.42553    
+
** 182.138    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0173_0001
+
** 7-methyluric acid
** Esi0173_0001
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[4.2.2.10-RXN]]
+
== Reaction(s) known to produce the compound ==
** Source: [[annotation-esiliculosus_genome]]
+
* [[RXN-11521]]
*** Assignment: automated-name-match
+
== Reaction(s) of unknown directionality ==
* Reaction: [[RXN-14897]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: automated-name-match
+
== Pathways associated ==
+
* [[PWY-7243]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1309712}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69160 69160]
{{#set: right end position=1319620}}
+
* CHEMSPIDER:
{{#set: centisome position=29.42553   }}
+
** [http://www.chemspider.com/Chemical-Structure.62375.html 62375]
{{#set: common name=Esi_0173_0001|Esi0173_0001}}
+
* CHEBI:
{{#set: reaction associated=4.2.2.10-RXN|RXN-14897}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80470 80470]
{{#set: pathway associated=PWY-7243}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16355 C16355]
 +
* HMDB : HMDB11107
 +
{{#set: smiles=CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))}}
 +
{{#set: inchi key=InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N}}
 +
{{#set: common name=7-methylurate}}
 +
{{#set: molecular weight=182.138   }}
 +
{{#set: common name=7-methyluric acid}}
 +
{{#set: produced by=RXN-11521}}

Latest revision as of 19:56, 21 March 2018

Metabolite CPD-12481

  • smiles:
    • CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
  • inchi key:
    • InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
  • common name:
    • 7-methylurate
  • molecular weight:
    • 182.138
  • Synonym(s):
    • 7-methyluric acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links