Difference between revisions of "Ec-03 000140"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-437 CPD1F-437] == * smiles: ** C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO...")
(Created page with "Category:Gene == Gene Ec-03_000140 == * Synonym(s): ** Esi_0027_0167 ** Esi0027_0167 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-437 CPD1F-437] ==
+
== Gene Ec-03_000140 ==
−
* smiles:
+
−
** C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))
+
−
* inchi key:
+
−
** InChIKey=OVSQVDMCBVZWGM-QSOFNFLRSA-M
+
−
* common name:
+
−
** quercetin-3-glucoside
+
−
* molecular weight:
+
−
** 463.374   
+
 
* Synonym(s):
 
* Synonym(s):
−
** quercetin-3-O-β-D-glucoside
+
** Esi_0027_0167
−
** isoquercetin
+
** Esi0027_0167
−
** isoquercitrin
+
−
** isotrifoliin
+
−
** glucosyl 3-quercetin
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-8443]]
−
* [[RXN1F-462]]
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=Esi_0027_0167|Esi0027_0167}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203368 25203368]
+
{{#set: reaction associated=RXN-8443}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-5381}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28299 28299]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C05623 C05623]
+
−
* HMDB : HMDB37362
+
−
{{#set: smiles=C1(C=C(O)C(O)=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))}}
+
−
{{#set: inchi key=InChIKey=OVSQVDMCBVZWGM-QSOFNFLRSA-M}}
+
−
{{#set: common name=quercetin-3-glucoside}}
+
−
{{#set: molecular weight=463.374    }}
+
−
{{#set: common name=quercetin-3-O-β-D-glucoside|isoquercetin|isoquercitrin|isotrifoliin|glucosyl 3-quercetin}}
+
−
{{#set: produced by=RXN1F-462}}
+

Latest revision as of 19:56, 21 March 2018

Gene Ec-03_000140

  • Synonym(s):
    • Esi_0027_0167
    • Esi0027_0167

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_000140&oldid=30471"