Difference between revisions of "RXN-16628"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE] == * smiles: ** C(OP([O-])(=O)[O-])C(=O)C(=O)[O-] * in...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16628 RXN-16628] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucose/ribitol dehydrogena...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16628 RXN-16628] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])(=O)[O-])C(=O)C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LFLUCDOSQPJJBE-UHFFFAOYSA-K
+
 
* common name:
 
* common name:
−
** 3-phospho-hydroxypyruvate
+
** Glucose/ribitol dehydrogenase
−
* molecular weight:
+
* ec number:
−
** 181.018   
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
−
** phosphohydroxypyruvate
 
−
** 3-phosphonooxypyruvate
 
−
** 3-P-hydroxypyruvate
 
−
** 3-p-OH-pyr
 
−
** 3-phosphohydroxypyruvate
 
−
** 3-p-OH-pyruvate
 
−
** 3-p-hydroxy-pyr
 
−
** 3-phosphohydroxy-pyr
 
−
** phosphohydroxypyruate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[2E-9Z-octadeca-2-9-dienoyl-ACPs]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Oleoyl-ACPs]][c]
−
* [[PSERTRANSAM-RXN]]
+
* With common name(s):
−
* [[PGLYCDEHYDROG-RXN]]
+
** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 a (2E,9Z)-octadeca-2,9-dienoyl-[acp][c] '''=>''' 1 NAD+[c] '''+''' 1 an oleoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_002470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7664]], oleate biosynthesis IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664]
 +
** '''10''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 3913-50-6
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : 41453
+
{{#set: common name=Glucose/ribitol dehydrogenase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.3.1.9}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460375 5460375]
+
{{#set: gene associated=Ec-27_002470}}
−
* HMDB : HMDB01024
+
{{#set: in pathway=PWY-7664}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03232 C03232]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.chemspider.com/Chemical-Structure.4573923.html 4573923]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18110 18110]
+
−
* METABOLIGHTS : MTBLC18110
+
−
{{#set: smiles=C(OP([O-])(=O)[O-])C(=O)C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=LFLUCDOSQPJJBE-UHFFFAOYSA-K}}
+
−
{{#set: common name=3-phospho-hydroxypyruvate}}
+
−
{{#set: molecular weight=181.018    }}
+
−
{{#set: common name=phosphohydroxypyruvate|3-phosphonooxypyruvate|3-P-hydroxypyruvate|3-p-OH-pyr|3-phosphohydroxypyruvate|3-p-OH-pyruvate|3-p-hydroxy-pyr|3-phosphohydroxy-pyr|phosphohydroxypyruate}}
+
−
{{#set: reversible reaction associated=PSERTRANSAM-RXN|PGLYCDEHYDROG-RXN}}
+

Latest revision as of 19:57, 21 March 2018

Reaction RXN-16628

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glucose/ribitol dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7664, oleate biosynthesis IV (anaerobic): PWY-7664
    • 10 reactions found over 14 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-16628&oldid=30481"