Difference between revisions of "PHOSPHORIBOSYL-AMP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-08_002720 == * left end position: ** 2539920 * transcription direction: ** NEGATIVE * right end position: ** 2553693 * centisome position: ** 37.9...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-AMP PHOSPHORIBOSYL-AMP] == * smiles: ** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(...")
 
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-08_002720 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-AMP PHOSPHORIBOSYL-AMP] ==
−
* left end position:
+
* smiles:
−
** 2539920
+
** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=RTQMRTSPTLIIHM-KEOHHSTQSA-J
−
* right end position:
+
* common name:
−
** 2553693
+
** 1-(5-phospho-β-D-ribosyl)-AMP
−
* centisome position:
+
* molecular weight:
−
** 37.925865    
+
** 555.288    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0007_0222
+
** 1-(5-phosphoribosyl)-AMP
−
** Esi0007_0222
+
** phosphoribosyl-AMP
 +
** 5-phosphoribosyl-AMP
 +
** N-(5-phospho-D-ribosyl)-AMP
 +
** N-(5'-phospho-D-ribosyl)-AMP
 +
** N1-(5-phospho-D-ribosyl)-AMP
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* Reaction: [[2.4.1.101-RXN]]
+
* [[HISTCYCLOHYD-RXN]]
−
** Source: [[annotation-esiliculosus_genome]]
+
== Reaction(s) known to produce the compound ==
−
*** Assignment: ec-number
+
* [[HISTPRATPHYD-RXN]]
−
* Reaction: [[2.4.1.223-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: go-term
+
−
== Pathways associated ==
+
−
* [[PWY-7426]]
+
−
* [[PWY-6558]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2539920}}
+
* LIGAND-CPD:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02741 C02741]
−
{{#set: right end position=2553693}}
+
* CHEBI:
−
{{#set: centisome position=37.925865   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59457 59457]
−
{{#set: common name=Esi_0007_0222|Esi0007_0222}}
+
* BIGG : 42711
−
{{#set: reaction associated=2.4.1.101-RXN|2.4.1.223-RXN}}
+
* PUBCHEM:
−
{{#set: pathway associated=PWY-7426|PWY-6558}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480652 45480652]
 +
* HMDB : HMDB12276
 +
{{#set: smiles=C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O}}
 +
{{#set: inchi key=InChIKey=RTQMRTSPTLIIHM-KEOHHSTQSA-J}}
 +
{{#set: common name=1-(5-phospho-β-D-ribosyl)-AMP}}
 +
{{#set: molecular weight=555.288   }}
 +
{{#set: common name=1-(5-phosphoribosyl)-AMP|phosphoribosyl-AMP|5-phosphoribosyl-AMP|N-(5-phospho-D-ribosyl)-AMP|N-(5'-phospho-D-ribosyl)-AMP|N1-(5-phospho-D-ribosyl)-AMP}}
 +
{{#set: consumed by=HISTCYCLOHYD-RXN}}
 +
{{#set: produced by=HISTPRATPHYD-RXN}}

Latest revision as of 20:57, 21 March 2018

Metabolite PHOSPHORIBOSYL-AMP

  • smiles:
    • C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O
  • inchi key:
    • InChIKey=RTQMRTSPTLIIHM-KEOHHSTQSA-J
  • common name:
    • 1-(5-phospho-β-D-ribosyl)-AMP
  • molecular weight:
    • 555.288
  • Synonym(s):
    • 1-(5-phosphoribosyl)-AMP
    • phosphoribosyl-AMP
    • 5-phosphoribosyl-AMP
    • N-(5-phospho-D-ribosyl)-AMP
    • N-(5'-phospho-D-ribosyl)-AMP
    • N1-(5-phospho-D-ribosyl)-AMP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PHOSPHORIBOSYL-AMP&oldid=30549"