Difference between revisions of "Ec-23 001790"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-707 CPD-707] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(...")
(Created page with "Category:Gene == Gene Ec-23_001790 == * left end position: ** 1810427 * transcription direction: ** NEGATIVE * right end position: ** 1817690 * centisome position: ** 37.4...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-707 CPD-707] ==
+
== Gene Ec-23_001790 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 1810427
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** campesterol
+
** 1817690
−
* molecular weight:
+
* centisome position:
−
** 400.687    
+
** 37.409637    
 
* Synonym(s):
 
* Synonym(s):
−
** cholest 5-en-3-ol, 24-methyl
+
** Esi_0042_0102
−
** ergost-5-en-3β-ol, (24R)-
+
** Esi0042_0102
−
** (24R)-24-methylcholest-5-en-3β-ol
+
−
** 24(R)-methylcholesterol
+
−
** campesterin
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-4225]]
+
* Reaction: [[RXN0-5359]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMST01030097
+
{{#set: left end position=1810427}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23424736 23424736]
+
{{#set: right end position=1817690}}
−
* HMDB : HMDB02869
+
{{#set: centisome position=37.409637   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0042_0102|Esi0042_0102}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01789 C01789]
+
{{#set: reaction associated=RXN0-5359}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.10469749.html 10469749]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28623 28623]
+
−
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N}}
+
−
{{#set: common name=campesterol}}
+
−
{{#set: molecular weight=400.687   }}
+
−
{{#set: common name=cholest 5-en-3-ol, 24-methyl|ergost-5-en-3β-ol, (24R)-|(24R)-24-methylcholest-5-en-3β-ol|24(R)-methylcholesterol|campesterin}}
+
−
{{#set: consumed by=RXN-4225}}
+

Latest revision as of 20:57, 21 March 2018

Gene Ec-23_001790

  • left end position:
    • 1810427
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1817690
  • centisome position:
    • 37.409637
  • Synonym(s):
    • Esi_0042_0102
    • Esi0042_0102

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-23_001790&oldid=30560"