Difference between revisions of "Ec-11 001030"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O * inchi...") |
(Created page with "Category:Gene == Gene Ec-11_001030 == * left end position: ** 1118259 * transcription direction: ** NEGATIVE * right end position: ** 1128035 * centisome position: ** 17.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-11_001030 == |
− | * | + | * left end position: |
− | ** | + | ** 1118259 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1128035 |
− | * | + | * centisome position: |
− | ** | + | ** 17.77933 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0102_0078 |
− | ** | + | ** Esi0102_0078 |
− | ** | + | ** IDI1 SQS |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[IPPISOM-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
− | * [[ | + | * Reaction: [[RXN-12263]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-13162]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-13724]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN66-281]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6174]] | ||
+ | * [[PWY-6859]] | ||
+ | * [[NONMEVIPP-PWY]] | ||
+ | * [[PWY-7560]] | ||
+ | * [[PWY-7391]] | ||
+ | * [[PWY-6767]] | ||
+ | * [[PWY-5670]] | ||
+ | * [[PWY-5123]] | ||
+ | * [[PWY-922]] | ||
+ | * [[PWY-5875]] | ||
+ | * [[PWY-6383]] | ||
+ | * [[PWY-6105]] | ||
+ | * [[PWY-7072]] | ||
+ | * [[PWY-7102]] | ||
+ | * [[PWY-7524]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1118259}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1128035}} | |
− | + | {{#set: centisome position=17.77933 }} | |
− | + | {{#set: common name=Esi_0102_0078|Esi0102_0078|IDI1 SQS}} | |
− | + | {{#set: reaction associated=IPPISOM-RXN|RXN-12263|RXN-13162|RXN-13724|RXN66-281}} | |
− | + | {{#set: pathway associated=PWY-6174|PWY-6859|NONMEVIPP-PWY|PWY-7560|PWY-7391|PWY-6767|PWY-5670|PWY-5123|PWY-922|PWY-5875|PWY-6383|PWY-6105|PWY-7072|PWY-7102|PWY-7524}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:58, 21 March 2018
Gene Ec-11_001030
- left end position:
- 1118259
- transcription direction:
- NEGATIVE
- right end position:
- 1128035
- centisome position:
- 17.77933
- Synonym(s):
- Esi_0102_0078
- Esi0102_0078
- IDI1 SQS
Reactions associated
- Reaction: IPPISOM-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12263
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Reaction: RXN-13162
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-13724
- Source: orthology-aragem
- Reaction: RXN66-281
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
Pathways associated
- PWY-6174
- PWY-6859
- NONMEVIPP-PWY
- PWY-7560
- PWY-7391
- PWY-6767
- PWY-5670
- PWY-5123
- PWY-922
- PWY-5875
- PWY-6383
- PWY-6105
- PWY-7072
- PWY-7102
- PWY-7524