Difference between revisions of "5-METHYL-THF-GLU-N"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KYNURENATE KYNURENATE] == * smiles: ** C1(C=C2(C(=CC=1)N=C(C(=O)[O-])C=C([O-])2)) * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYL-THF-GLU-N 5-METHYL-THF-GLU-N] == * common name: ** an N5-methyl-tetrahydrofolate * Syn...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-METHYL-THF-GLU-N 5-METHYL-THF-GLU-N] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an N5-methyl-tetrahydrofolate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.1.1.19-RXN]] | ||
| + | * [[HOMOCYSMETB12-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[1.5.1.20-RXN]] |
| + | * [[RXN-5061]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an N5-methyl-tetrahydrofolate}} | |
| − | + | {{#set: consumed by=2.1.1.19-RXN|HOMOCYSMETB12-RXN}} | |
| − | + | {{#set: produced by=1.5.1.20-RXN|RXN-5061}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: produced by=RXN- | + | |
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite 5-METHYL-THF-GLU-N
- common name:
- an N5-methyl-tetrahydrofolate
- Synonym(s):
