Difference between revisions of "Poly-Gamma-Glutamylcysteine-Glycines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] == * smiles: ** C(=O)([O-])C(=O)CS(=O)(=O)[O-] * inchi key: ** InChIKey=BUTHMS...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-Gamma-Glutamylcysteine-Glycines Poly-Gamma-Glutamylcysteine-Glycines] == * common name: **...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-Gamma-Glutamylcysteine-Glycines Poly-Gamma-Glutamylcysteine-Glycines] ==
* smiles:
+
** C(=O)([O-])C(=O)CS(=O)(=O)[O-]
+
* inchi key:
+
** InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
** 3-sulfopyruvate
+
** a poly-[γ-glutamylcysteine]-glycine
* molecular weight:
+
** 166.105   
+
 
* Synonym(s):
 
* Synonym(s):
** sulfopyruvate
+
** a phytochelatin
** 3-Sulfopyruvic acid
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.3.2.15-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.3.2.15-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-11737]]
 
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=a poly-[γ-glutamylcysteine]-glycine}}
** [http://www.genome.jp/dbget-bin/www_bget?C05528 C05528]
+
{{#set: common name=a phytochelatin}}
* CHEBI:
+
{{#set: consumed by=2.3.2.15-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57940 57940]
+
{{#set: produced by=2.3.2.15-RXN}}
* METABOLIGHTS : MTBLC57940
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245217 25245217]
+
* HMDB : HMDB04045
+
{{#set: smiles=C(=O)([O-])C(=O)CS(=O)(=O)[O-]}}
+
{{#set: inchi key=InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L}}
+
{{#set: common name=3-sulfopyruvate}}
+
{{#set: molecular weight=166.105    }}
+
{{#set: common name=sulfopyruvate|3-Sulfopyruvic acid}}
+
{{#set: reversible reaction associated=RXN-11737}}
+

Latest revision as of 19:59, 21 March 2018

Metabolite Poly-Gamma-Glutamylcysteine-Glycines

  • common name:
    • a poly-[γ-glutamylcysteine]-glycine
  • Synonym(s):
    • a phytochelatin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a poly-[γ-glutamylcysteine]-glycine" cannot be used as a page name in this wiki.