Difference between revisions of "CPD-710"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] == |
* smiles: | * smiles: | ||
− | ** CC(C) | + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N |
* common name: | * common name: | ||
− | ** | + | ** campestanol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 402.702 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5α-campestanol |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-773]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202034 25202034] |
− | + | ||
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15787 C15787] |
− | + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | |
− | {{#set: smiles=CC(C) | + | {{#set: inchi key=InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=campestanol}} |
− | {{#set: common name= | + | {{#set: molecular weight=402.702 }} |
− | {{#set: molecular weight= | + | {{#set: common name=5α-campestanol}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN-773}} |
− | {{#set: | + |
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite CPD-710
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
- common name:
- campestanol
- molecular weight:
- 402.702
- Synonym(s):
- 5α-campestanol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.