Difference between revisions of "CPD-16953"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] == * smiles: ** CC(=O)C(C)(O)C(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == * smiles: ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) * inchi key: ** InChI...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 223.234 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15733]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658804 90658804] |
| − | + | {{#set: smiles=CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))}} | |
| − | + | {{#set: inchi key=InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N}} | |
| − | + | {{#set: common name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}} | |
| − | + | {{#set: molecular weight=223.234 }} | |
| − | + | {{#set: consumed by=RXN-15733}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: smiles= | + | |
| − | {{#set: inchi key=InChIKey= | + | |
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite CPD-16953
- smiles:
- CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))
- inchi key:
- InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N
- common name:
- 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
- molecular weight:
- 223.234
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" cannot be used as a page name in this wiki.
