Difference between revisions of "CPD0-2461"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Xyloglucans-Galactose-23 Xyloglucans-Galactose-23] == * common name: ** an XLLG xylogulcan * Sy...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] == * smiles: ** C2(=NC1(=C(NC(N=C(N)1)=O)N2)) * inchi key: ** InChIKey=DRA...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Xyloglucans-Galactose-23 Xyloglucans-Galactose-23] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] ==
 +
* smiles:
 +
** C2(=NC1(=C(NC(N=C(N)1)=O)N2))
 +
* inchi key:
 +
** InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N
 
* common name:
 
* common name:
** an XLLG xylogulcan
+
** isoguanine
 +
* molecular weight:
 +
** 151.127   
 
* Synonym(s):
 
* Synonym(s):
** a xyloglucan with galactose side chain at positions 2 and 3
+
** 2-oxoadenine
 +
** 2-hydroxyadenine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9463]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15139]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=an XLLG xylogulcan}}
+
* PUBCHEM:
{{#set: common name=a xyloglucan with galactose side chain at positions 2 and 3}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=76900 76900]
{{#set: consumed by=RXN-9463}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.69351.html 69351]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62462 62462]
 +
* HMDB : HMDB00403
 +
{{#set: smiles=C2(=NC1(=C(NC(N=C(N)1)=O)N2))}}
 +
{{#set: inchi key=InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N}}
 +
{{#set: common name=isoguanine}}
 +
{{#set: molecular weight=151.127    }}
 +
{{#set: common name=2-oxoadenine|2-hydroxyadenine}}
 +
{{#set: produced by=RXN-15139}}

Latest revision as of 20:00, 21 March 2018

Metabolite CPD0-2461

  • smiles:
    • C2(=NC1(=C(NC(N=C(N)1)=O)N2))
  • inchi key:
    • InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N
  • common name:
    • isoguanine
  • molecular weight:
    • 151.127
  • Synonym(s):
    • 2-oxoadenine
    • 2-hydroxyadenine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links