Difference between revisions of "N6-L-threonylcarbamoyladenine37-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OCC2(C(O)C(C([N+]1(C=CC=C(C(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6-L-threonylcarbamoyladenine37-tRNAs N6-L-threonylcarbamoyladenine37-tRNAs] == * common name:...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6-L-threonylcarbamoyladenine37-tRNAs N6-L-threonylcarbamoyladenine37-tRNAs] ==
* smiles:
+
** C(OP(=O)([O-])OP(=O)([O-])OCC2(C(O)C(C([N+]1(C=CC=C(C([O-])=O)C=1))O2)O))C3(C(O)C(O)C(O3)N5(C=NC4(C(N)=NC=NC=45)))
+
* inchi key:
+
** InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L
+
 
* common name:
 
* common name:
** nicotinate adenine dinucleotide
+
** N6-L-threonylcarbamoyladenine37 in tRNA
* molecular weight:
+
** 662.399   
+
 
* Synonym(s):
 
* Synonym(s):
** Deamino-NAD+
 
** NaADN
 
** deamido-NAD+
 
** deamidonicotinamide adenine dinucleoetide
 
** deamido-NAD
 
** NAAD
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NAD-SYNTH-NH3-RXN]]
 
* [[NAD-SYNTH-GLN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NICONUCADENYLYLTRAN-RXN]]
+
* [[RXN-14570]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 6450-77-7
+
{{#set: common name=N6-L-threonylcarbamoyladenine37 in tRNA}}
* DRUGBANK : DB04099
+
{{#set: produced by=RXN-14570}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266646 45266646]
+
* HMDB : HMDB01179
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00857 C00857]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58437 58437]
+
* BIGG : 36219
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OCC2(C(O)C(C([N+]1(C=CC=C(C([O-])=O)C=1))O2)O))C3(C(O)C(O)C(O3)N5(C=NC4(C(N)=NC=NC=45)))}}
+
{{#set: inchi key=InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L}}
+
{{#set: common name=nicotinate adenine dinucleotide}}
+
{{#set: molecular weight=662.399    }}
+
{{#set: common name=Deamino-NAD+|NaADN|deamido-NAD+|deamidonicotinamide adenine dinucleoetide|deamido-NAD|NAAD}}
+
{{#set: consumed by=NAD-SYNTH-NH3-RXN|NAD-SYNTH-GLN-RXN}}
+
{{#set: produced by=NICONUCADENYLYLTRAN-RXN}}
+

Latest revision as of 20:00, 21 March 2018

Metabolite N6-L-threonylcarbamoyladenine37-tRNAs

  • common name:
    • N6-L-threonylcarbamoyladenine37 in tRNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links