Difference between revisions of "2-2-N-linked-Glycan"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ALPHA-ACETYLORNITHINE N-ALPHA-ACETYLORNITHINE] == * smiles: ** CC(=O)NC(CCC[N+])C(=O)[O-] * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-2-N-linked-Glycan 2-2-N-linked-Glycan] == * common name: ** N4-{N-acetyl-β-D-glucosaminy...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-2-N-linked-Glycan 2-2-N-linked-Glycan] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** N-acetyl-L- | + | ** N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-protein-L-asparagine |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GnGn-GP |
− | ** | + | ** GnGn-glycopeptide |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.4.1.145-RXN]] |
+ | * [[2.4.1.144-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.4.1.143-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[2.4.2.38-RXN]] |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: common name=N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-protein-L-asparagine}} | |
− | + | {{#set: common name=GnGn-GP|GnGn-glycopeptide}} | |
− | + | {{#set: consumed by=2.4.1.145-RXN|2.4.1.144-RXN}} | |
− | + | {{#set: produced by=2.4.1.143-RXN}} | |
− | + | {{#set: reversible reaction associated=2.4.2.38-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: reversible reaction associated= | + |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite 2-2-N-linked-Glycan
- common name:
- N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-protein-L-asparagine
- Synonym(s):
- GnGn-GP
- GnGn-glycopeptide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-protein-L-asparagine" cannot be used as a page name in this wiki.