Difference between revisions of "Ec-01 006640"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-01_006640 == * left end position: ** 5718248 * transcription direction: ** POSITIVE * right end position: ** 5720244 * centisome position: ** 55.4...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] == * smiles: ** CC1(OC(C(C(C1O)O)O)O) * inchi key: ** InChIKey=SHZGCJCMOBC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-01_006640 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] ==
−
* left end position:
+
* smiles:
−
** 5718248
+
** CC1(OC(C(C(C1O)O)O)O)
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N
−
* right end position:
+
* common name:
−
** 5720244
+
** β-L-fucopyranose
−
* centisome position:
+
* molecular weight:
−
** 55.41564    
+
** 164.158    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0002_0278
+
** β-L-fucose
−
** Esi0002_0278
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
== Reaction(s) of unknown directionality ==
−
***go-term
+
* [[RXN0-5298]]
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=5718248}}
+
* DRUGBANK : DB03283
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=5720244}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=444863 444863]
−
{{#set: centisome position=55.41564   }}
+
* HMDB : HMDB59625
−
{{#set: common name=Esi_0002_0278|Esi0002_0278}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01019 C01019]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.392667.html 392667]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42589 42589]
 +
{{#set: smiles=CC1(OC(C(C(C1O)O)O)O)}}
 +
{{#set: inchi key=InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N}}
 +
{{#set: common name=β-L-fucopyranose}}
 +
{{#set: molecular weight=164.158   }}
 +
{{#set: common name=β-L-fucose}}
 +
{{#set: reversible reaction associated=RXN0-5298}}

Revision as of 20:22, 17 March 2018

Metabolite CPD0-1107

  • smiles:
    • CC1(OC(C(C(C1O)O)O)O)
  • inchi key:
    • InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N
  • common name:
    • β-L-fucopyranose
  • molecular weight:
    • 164.158
  • Synonym(s):
    • β-L-fucose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_006640&oldid=8622"