Difference between revisions of "Ec-09 004230"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-09_004230 == * left end position: ** 4762194 * transcription direction: ** NEGATIVE * right end position: ** 4767531 * centisome position: ** 84.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * inchi key: ** InChIKey=WG...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M |
| − | * | + | * common name: |
| − | ** | + | ** 4-methylphenyl sulfate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 187.19 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** p-cresol sulfate |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-15588]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4615422 4615422] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.3806481.html 3806481] |
| − | {{#set: common name= | + | * HMDB : HMDB11635 |
| − | {{#set: reaction associated= | + | {{#set: smiles=CC1(C=CC(=CC=1)OS(=O)(=O)[O-])}} |
| − | + | {{#set: inchi key=InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M}} | |
| + | {{#set: common name=4-methylphenyl sulfate}} | ||
| + | {{#set: molecular weight=187.19 }} | ||
| + | {{#set: common name=p-cresol sulfate}} | ||
| + | {{#set: reversible reaction associated=RXN-15588}} | ||
Revision as of 20:22, 17 March 2018
Contents
Metabolite CPD-16819
- smiles:
- CC1(C=CC(=CC=1)OS(=O)(=O)[O-])
- inchi key:
- InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M
- common name:
- 4-methylphenyl sulfate
- molecular weight:
- 187.19
- Synonym(s):
- p-cresol sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(C=CC(=CC=1)OS(=O)(=O)[O-])" cannot be used as a page name in this wiki.
