Difference between revisions of "Ec-03 005020"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] == * smiles: ** CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-] * in...") |
(Created page with "Category:Gene == Gene Ec-04_006300 == * left end position: ** 6214439 * transcription direction: ** POSITIVE * right end position: ** 6223273 * centisome position: ** 95.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-04_006300 == |
− | * | + | * left end position: |
− | ** | + | ** 6214439 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 6223273 |
− | * | + | * centisome position: |
− | ** | + | ** 95.432755 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0134_0030 |
− | ** | + | ** Esi0134_0030 |
− | ** | + | ** PGDH |
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PGLYCDEHYDROG-RXN]] |
− | + | ** esiliculosus_genome | |
− | * [[ | + | ***ec-number |
− | + | ** [[pantograph]]-[[aragem]] | |
− | == | + | == Pathways associated == |
− | * [[ | + | * [[SERSYN-PWY]] |
== External links == | == External links == | ||
− | + | {{#set: left end position=6214439}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=6223273}} | |
− | + | {{#set: centisome position=95.432755 }} | |
− | + | {{#set: common name=Esi_0134_0030|Esi0134_0030|PGDH}} | |
− | + | {{#set: reaction associated=PGLYCDEHYDROG-RXN}} | |
− | + | {{#set: pathway associated=SERSYN-PWY}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 21:23, 17 March 2018
Gene Ec-04_006300
- left end position:
- 6214439
- transcription direction:
- POSITIVE
- right end position:
- 6223273
- centisome position:
- 95.432755
- Synonym(s):
- Esi_0134_0030
- Esi0134_0030
- PGDH
Reactions associated
- PGLYCDEHYDROG-RXN
- esiliculosus_genome
- ec-number
- pantograph-aragem
- esiliculosus_genome