Difference between revisions of "Ec-01 004320"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-16_001530 == * left end position: ** 1736141 * transcription direction: ** NEGATIVE * right end position: ** 1746623 * centisome position: ** 32.5...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-16_001530 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
−
* left end position:
+
* smiles:
−
** 1736141
+
** C(CC[N+]CCCCC[N+])[N+]
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
−
* right end position:
+
* common name:
−
** 1746623
+
** aminopropylcadaverine
−
* centisome position:
+
* molecular weight:
−
** 32.526295    
+
** 162.298    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0488_0009
+
** N-3-aminopropyl-1,5-diaminopentane
−
** Esi0488_0009
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ATPASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN0-5217]]
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1736141}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
−
{{#set: right end position=1746623}}
+
* CHEBI:
−
{{#set: centisome position=32.526295   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
−
{{#set: common name=Esi_0488_0009|Esi0488_0009}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=ATPASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
 +
* HMDB : HMDB12189
 +
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
 +
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
 +
{{#set: common name=aminopropylcadaverine}}
 +
{{#set: molecular weight=162.298   }}
 +
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
 +
{{#set: produced by=RXN0-5217}}

Revision as of 20:24, 17 March 2018

Metabolite CPD0-1065

  • smiles:
    • C(CC[N+]CCCCC[N+])[N+]
  • inchi key:
    • InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
  • common name:
    • aminopropylcadaverine
  • molecular weight:
    • 162.298
  • Synonym(s):
    • N-3-aminopropyl-1,5-diaminopentane

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC[N+]CCCCC[N+])[N+" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_004320&oldid=8804"